C13H17BrClN3S — CID 114652684
N-[(5-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine (PubChem CID 114652684) has the molecular formula C13H17BrClN3S and a molecular weight of 362.72 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114652684 |
| Molecular Formula | C13H17BrClN3S |
| Molecular Weight | 362.72 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)-(4-chloro-1-propylpyrazol-5-yl)methyl]ethanamine |
| SMILES | CCCn1ncc(Cl)c1C(NCC)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H17BrClN3S/c1-3-7-18-13(9(15)8-17-18)12(16-4-2)10-5-6-11(14)19-10/h5-6,8,12,16H,3-4,7H2,1-2H3 |
| InChIKey | BYRLZPTXQBYHHA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |