C12H15FN4 — CID 105043613
1-(2-fluoro-3-methylphenyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine (PubChem CID 105043613) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-(2-fluoro-3-methylphenyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine.
| Compound Name | 1-(2-fluoro-3-methylphenyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105043613 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(2-fluoro-3-methylphenyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine |
| SMILES | CNC(c1cccc(C)c1F)c1cnnn1C |
| InChI | InChI=1S/C12H15FN4/c1-8-5-4-6-9(11(8)13)12(14-2)10-7-15-16-17(10)3/h4-7,12,14H,1-3H3 |
| InChIKey | YDRXKMGEBMDILL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |