C10H12FN5 — CID 114688577
1-(5-fluoro-2-pyridinyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine (PubChem CID 114688577) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114688577 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N-methyl-1-(3-methyltriazol-4-yl)methanamine |
| SMILES | CNC(c1ccc(F)cn1)c1cnnn1C |
| InChI | InChI=1S/C10H12FN5/c1-12-10(9-6-14-15-16(9)2)8-4-3-7(11)5-13-8/h3-6,10,12H,1-2H3 |
| InChIKey | GQJBJCWIRURNLY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |