C10H13BrN4O — CID 105043781
N-[(5-bromofuran-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 105043781) has the molecular formula C10H13BrN4O and a molecular weight of 285.15 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromofuran-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105043781 |
| Molecular Formula | C10H13BrN4O |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)o1)c1cnnn1C |
| InChI | InChI=1S/C10H13BrN4O/c1-3-12-10(7-6-13-14-15(7)2)8-4-5-9(11)16-8/h4-6,10,12H,3H2,1-2H3 |
| InChIKey | QGGFMTRDTLQLFF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |