C11H15BrN4S — CID 105043393
N-[(5-bromo-4-methylthiophen-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 105043393) has the molecular formula C11H15BrN4S and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[(5-bromo-4-methylthiophen-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105043393 |
| Molecular Formula | C11H15BrN4S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(C)c(Br)s1)c1cnnn1C |
| InChI | InChI=1S/C11H15BrN4S/c1-4-13-10(8-6-14-15-16(8)3)9-5-7(2)11(12)17-9/h5-6,10,13H,4H2,1-3H3 |
| InChIKey | ZUASGBFBJGGJFN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |