C19H27N — CID 105044882
N-[3-bicyclo[3.1.0]hexanyl-(4-cyclobutylphenyl)methyl]ethanamine (PubChem CID 105044882) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is N-[3-bicyclo[3.1.0]hexanyl-(4-cyclobutylphenyl)methyl]ethanamine.
| Compound Name | N-[3-bicyclo[3.1.0]hexanyl-(4-cyclobutylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105044882 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-[3-bicyclo[3.1.0]hexanyl-(4-cyclobutylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C2CCC2)cc1)C1CC2CC2C1 |
| InChI | InChI=1S/C19H27N/c1-2-20-19(18-11-16-10-17(16)12-18)15-8-6-14(7-9-15)13-4-3-5-13/h6-9,13,16-20H,2-5,10-12H2,1H3 |
| InChIKey | TVMGSOAURUAEOW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |