C13H14BrCl2N3 — CID 105046639
N-[(3-bromo-2-chlorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methyl]ethanamine (PubChem CID 105046639) has the molecular formula C13H14BrCl2N3 and a molecular weight of 363.09 g/mol. Its IUPAC name is N-[(3-bromo-2-chlorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2-chlorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105046639 |
| Molecular Formula | C13H14BrCl2N3 |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | N-[(3-bromo-2-chlorophenyl)-(4-chloro-1-methylpyrazol-5-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Br)c1Cl)c1c(Cl)cnn1C |
| InChI | InChI=1S/C13H14BrCl2N3/c1-3-17-12(13-10(15)7-18-19(13)2)8-5-4-6-9(14)11(8)16/h4-7,12,17H,3H2,1-2H3 |
| InChIKey | FFYGERLRWHGEHD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |