C12H10F5N3O — CID 105046927
(4-methoxy-1-methylpyrazol-5-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 105046927) has the molecular formula C12H10F5N3O and a molecular weight of 307.22 g/mol. Its IUPAC name is (4-methoxy-1-methylpyrazol-5-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | (4-methoxy-1-methylpyrazol-5-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 105046927 |
| Molecular Formula | C12H10F5N3O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (4-methoxy-1-methylpyrazol-5-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | COc1cnn(C)c1C(N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5N3O/c1-20-12(4(21-2)3-19-20)11(18)5-6(13)8(15)10(17)9(16)7(5)14/h3,11H,18H2,1-2H3 |
| InChIKey | SHQAKIOJIVZEIN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|