C7H10F2N2O2 — CID 114645393
2,2-difluoro-1-(4-methoxy-1-methylpyrazol-5-yl)ethanol (PubChem CID 114645393) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-methoxy-1-methylpyrazol-5-yl)ethanol.
| Compound Name | 2,2-difluoro-1-(4-methoxy-1-methylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 114645393 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2,2-difluoro-1-(4-methoxy-1-methylpyrazol-5-yl)ethanol |
| SMILES | COc1cnn(C)c1C(O)C(F)F |
| InChI | InChI=1S/C7H10F2N2O2/c1-11-5(6(12)7(8)9)4(13-2)3-10-11/h3,6-7,12H,1-2H3 |
| InChIKey | ZQTSDYDPVIBYTJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |