C11H20N2O3 — CID 103449219
2-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)butane-1,2-diol (PubChem CID 103449219) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)butane-1,2-diol.
| Compound Name | 2-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 103449219 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)butane-1,2-diol |
| SMILES | CCC(O)(CC)C(O)c1c(OC)cnn1C |
| InChI | InChI=1S/C11H20N2O3/c1-5-11(15,6-2)10(14)9-8(16-4)7-12-13(9)3/h7,10,14-15H,5-6H2,1-4H3 |
| InChIKey | DPJDKSIONXFUFJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |