C13H14F3N3O — CID 105047748
(1-ethyl-4-methoxypyrazol-5-yl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 105047748) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is (1-ethyl-4-methoxypyrazol-5-yl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (1-ethyl-4-methoxypyrazol-5-yl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105047748 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1-ethyl-4-methoxypyrazol-5-yl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CCn1ncc(OC)c1C(N)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H14F3N3O/c1-3-19-13(9(20-2)6-18-19)12(17)7-4-5-8(14)11(16)10(7)15/h4-6,12H,3,17H2,1-2H3 |
| InChIKey | LEWWBFRPQASCMH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|