C13H15BrFN3O — CID 114660068
(3-bromo-4-fluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanamine (PubChem CID 114660068) has the molecular formula C13H15BrFN3O and a molecular weight of 328.19 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanamine.
| Compound Name | (3-bromo-4-fluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 114660068 |
| Molecular Formula | C13H15BrFN3O |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-(1-ethyl-4-methoxypyrazol-5-yl)methanamine |
| SMILES | CCn1ncc(OC)c1C(N)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H15BrFN3O/c1-3-18-13(11(19-2)7-17-18)12(16)8-4-5-10(15)9(14)6-8/h4-7,12H,3,16H2,1-2H3 |
| InChIKey | TZFDGOMUMZISPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |