C14H17BrFN3O2 — CID 105042891
[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-fluoro-3-methoxyphenyl)methanamine (PubChem CID 105042891) has the molecular formula C14H17BrFN3O2 and a molecular weight of 358.21 g/mol. Its IUPAC name is [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-fluoro-3-methoxyphenyl)methanamine.
| Compound Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-fluoro-3-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 105042891 |
| Molecular Formula | C14H17BrFN3O2 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-fluoro-3-methoxyphenyl)methanamine |
| SMILES | COCCn1ncc(Br)c1C(N)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C14H17BrFN3O2/c1-20-6-5-19-14(10(15)8-18-19)13(17)9-3-4-11(16)12(7-9)21-2/h3-4,7-8,13H,5-6,17H2,1-2H3 |
| InChIKey | RQSODVCMJJFIJJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |