C13H14Br2ClN3O — CID 107946811
(3-bromo-5-chlorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanamine (PubChem CID 107946811) has the molecular formula C13H14Br2ClN3O and a molecular weight of 423.54 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanamine.
| Compound Name | (3-bromo-5-chlorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 107946811 |
| Molecular Formula | C13H14Br2ClN3O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 420.92 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]methanamine |
| SMILES | COCCn1ncc(Br)c1C(N)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C13H14Br2ClN3O/c1-20-3-2-19-13(11(15)7-18-19)12(17)8-4-9(14)6-10(16)5-8/h4-7,12H,2-3,17H2,1H3 |
| InChIKey | FERQRNDPOLTIFV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |