C15H20BrN3O2 — CID 114659333
[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxy-3-methylphenyl)methanamine (PubChem CID 114659333) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxy-3-methylphenyl)methanamine.
| Compound Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxy-3-methylphenyl)methanamine |
|---|---|
| PubChem CID | 114659333 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(4-methoxy-3-methylphenyl)methanamine |
| SMILES | COCCn1ncc(Br)c1C(N)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-10-8-11(4-5-13(10)21-3)14(17)15-12(16)9-18-19(15)6-7-20-2/h4-5,8-9,14H,6-7,17H2,1-3H3 |
| InChIKey | ZXAHSCVBTCDNDL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |