C15H16INO2 — CID 105051973
(2,6-dimethoxyphenyl)-(3-iodophenyl)methanamine (PubChem CID 105051973) has the molecular formula C15H16INO2 and a molecular weight of 369.20 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(3-iodophenyl)methanamine.
| Compound Name | (2,6-dimethoxyphenyl)-(3-iodophenyl)methanamine |
|---|---|
| PubChem CID | 105051973 |
| Molecular Formula | C15H16INO2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(3-iodophenyl)methanamine |
| SMILES | COc1cccc(OC)c1C(N)c1cccc(I)c1 |
| InChI | InChI=1S/C15H16INO2/c1-18-12-7-4-8-13(19-2)14(12)15(17)10-5-3-6-11(16)9-10/h3-9,15H,17H2,1-2H3 |
| InChIKey | AGSYURQSFGKXOF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|