C17H22N2O2 — CID 105188768
4-[amino-(2,6-dimethoxyphenyl)methyl]-N,N-dimethylaniline (PubChem CID 105188768) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[amino-(2,6-dimethoxyphenyl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[amino-(2,6-dimethoxyphenyl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105188768 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[amino-(2,6-dimethoxyphenyl)methyl]-N,N-dimethylaniline |
| SMILES | COc1cccc(OC)c1C(N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-19(2)13-10-8-12(9-11-13)17(18)16-14(20-3)6-5-7-15(16)21-4/h5-11,17H,18H2,1-4H3 |
| InChIKey | QIRRYUYNXCRVPN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |