C18H19ClFN — CID 105052491
N-[(2-chloro-6-fluorophenyl)-(2-phenylcyclopropyl)methyl]ethanamine (PubChem CID 105052491) has the molecular formula C18H19ClFN and a molecular weight of 303.81 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)-(2-phenylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)-(2-phenylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105052491 |
| Molecular Formula | C18H19ClFN |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)-(2-phenylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(c1c(F)cccc1Cl)C1CC1c1ccccc1 |
| InChI | InChI=1S/C18H19ClFN/c1-2-21-18(17-15(19)9-6-10-16(17)20)14-11-13(14)12-7-4-3-5-8-12/h3-10,13-14,18,21H,2,11H2,1H3 |
| InChIKey | ZYMWBPODDFSXKS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |