C19H22ClN — CID 116517442
N-[(2-chlorophenyl)-(2-phenylcyclopropyl)methyl]propan-1-amine (PubChem CID 116517442) has the molecular formula C19H22ClN and a molecular weight of 299.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(2-phenylcyclopropyl)methyl]propan-1-amine.
| Compound Name | N-[(2-chlorophenyl)-(2-phenylcyclopropyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 116517442 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[(2-chlorophenyl)-(2-phenylcyclopropyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccccc1Cl)C1CC1c1ccccc1 |
| InChI | InChI=1S/C19H22ClN/c1-2-12-21-19(15-10-6-7-11-18(15)20)17-13-16(17)14-8-4-3-5-9-14/h3-11,16-17,19,21H,2,12-13H2,1H3 |
| InChIKey | HPVTUQHASJOAME-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |