C32H46O4 — CID 10505375
[(4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicen-4a-yl]methyl acetate (PubChem CID 10505375) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is [(4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicen-4a-yl]methyl acetate.
| Compound Name | [(4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicen-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 10505375 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [(4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,14b-decahydropicen-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CCC(C)(C)C[C@H]1C1=CC(=O)[C@@H]3[C@@]4(C)C=CC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H46O4/c1-20(33)36-19-32-15-13-27(2,3)18-22(32)21-17-23(34)26-29(6)11-10-25(35)28(4,5)24(29)9-12-31(26,8)30(21,7)14-16-32/h10-11,17,22,24,26H,9,12-16,18-19H2,1-8H3/t22-,24-,26+,29-,30+,31+,32+/m0/s1 |
| InChIKey | QXNWMGKAXHMBLY-SCQSLXDNSA-N |
| XLogP | 6.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |