C30H42O4 — CID 71130811
methyl (2S,4aR,6aR,6aS,6bR,8aR,12aS,14bR)-4a,6a,6b,9,9,12a-hexamethyl-10,13-dioxo-2,3,4,5,6,6a,7,8,8a,14b-decahydro-1H-picene-2-carboxylate (PubChem CID 71130811) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is methyl (2S,4aR,6aR,6aS,6bR,8aR,12aS,14bR)-4a,6a,6b,9,9,12a-hexamethyl-10,13-dioxo-2,3,4,5,6,6a,7,8,8a,14b-decahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2S,4aR,6aR,6aS,6bR,8aR,12aS,14bR)-4a,6a,6b,9,9,12a-hexamethyl-10,13-dioxo-2,3,4,5,6,6a,7,8,8a,14b-decahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 71130811 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | methyl (2S,4aR,6aR,6aS,6bR,8aR,12aS,14bR)-4a,6a,6b,9,9,12a-hexamethyl-10,13-dioxo-2,3,4,5,6,6a,7,8,8a,14b-decahydro-1H-picene-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)C=CC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C30H42O4/c1-26(2)22-9-13-30(6)24(28(22,4)12-10-23(26)32)21(31)17-20-19-16-18(25(33)34-7)8-11-27(19,3)14-15-29(20,30)5/h10,12,17-19,22,24H,8-9,11,13-16H2,1-7H3/t18-,19-,22-,24+,27+,28-,29+,30+/m0/s1 |
| InChIKey | APIMBRBKLFPVQW-FIBFPJGESA-N |
| XLogP | 6.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |