C17H25ClFN — CID 105055283
2-(4-chloro-2-fluorophenyl)-1-[1-(2-methylpropyl)cyclopentyl]ethanamine (PubChem CID 105055283) has the molecular formula C17H25ClFN and a molecular weight of 297.84 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-[1-(2-methylpropyl)cyclopentyl]ethanamine.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-[1-(2-methylpropyl)cyclopentyl]ethanamine |
|---|---|
| PubChem CID | 105055283 |
| Molecular Formula | C17H25ClFN |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-[1-(2-methylpropyl)cyclopentyl]ethanamine |
| SMILES | CC(C)CC1(C(N)Cc2ccc(Cl)cc2F)CCCC1 |
| InChI | InChI=1S/C17H25ClFN/c1-12(2)11-17(7-3-4-8-17)16(20)9-13-5-6-14(18)10-15(13)19/h5-6,10,12,16H,3-4,7-9,11,20H2,1-2H3 |
| InChIKey | WXTJIZHGFDOIQT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |