C16H22ClF2N — CID 107475917
(2-chloro-4,5-difluorophenyl)-[1-(2-methylpropyl)cyclopentyl]methanamine (PubChem CID 107475917) has the molecular formula C16H22ClF2N and a molecular weight of 301.81 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[1-(2-methylpropyl)cyclopentyl]methanamine.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[1-(2-methylpropyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 107475917 |
| Molecular Formula | C16H22ClF2N |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[1-(2-methylpropyl)cyclopentyl]methanamine |
| SMILES | CC(C)CC1(C(N)c2cc(F)c(F)cc2Cl)CCCC1 |
| InChI | InChI=1S/C16H22ClF2N/c1-10(2)9-16(5-3-4-6-16)15(20)11-7-13(18)14(19)8-12(11)17/h7-8,10,15H,3-6,9,20H2,1-2H3 |
| InChIKey | FSPNJSDRIUOFII-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|