C17H24ClFO — CID 81045388
(2-chloro-4-fluoro-5-methylphenyl)-[1-(2-methylpropyl)cyclopentyl]methanol (PubChem CID 81045388) has the molecular formula C17H24ClFO and a molecular weight of 298.83 g/mol. Its IUPAC name is (2-chloro-4-fluoro-5-methylphenyl)-[1-(2-methylpropyl)cyclopentyl]methanol.
| Compound Name | (2-chloro-4-fluoro-5-methylphenyl)-[1-(2-methylpropyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 81045388 |
| Molecular Formula | C17H24ClFO |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2-chloro-4-fluoro-5-methylphenyl)-[1-(2-methylpropyl)cyclopentyl]methanol |
| SMILES | Cc1cc(C(O)C2(CC(C)C)CCCC2)c(Cl)cc1F |
| InChI | InChI=1S/C17H24ClFO/c1-11(2)10-17(6-4-5-7-17)16(20)13-8-12(3)15(19)9-14(13)18/h8-9,11,16,20H,4-7,10H2,1-3H3 |
| InChIKey | ZGMFPBFWVRAXFP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |