C16H19N3O2 — CID 105058494
4-[(1-hydroxy-2-phenylpropan-2-yl)amino]-N-methylpyridine-2-carboxamide (PubChem CID 105058494) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-[(1-hydroxy-2-phenylpropan-2-yl)amino]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[(1-hydroxy-2-phenylpropan-2-yl)amino]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 105058494 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-[(1-hydroxy-2-phenylpropan-2-yl)amino]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(NC(C)(CO)c2ccccc2)ccn1 |
| InChI | InChI=1S/C16H19N3O2/c1-16(11-20,12-6-4-3-5-7-12)19-13-8-9-18-14(10-13)15(21)17-2/h3-10,20H,11H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | RBTAPNACGYSSQE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |