C17H26ClNO — CID 105059797
N-(1-chloro-2-phenylpropan-2-yl)-3,4,4-trimethylpentanamide (PubChem CID 105059797) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is N-(1-chloro-2-phenylpropan-2-yl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(1-chloro-2-phenylpropan-2-yl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 105059797 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(1-chloro-2-phenylpropan-2-yl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NC(C)(CCl)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H26ClNO/c1-13(16(2,3)4)11-15(20)19-17(5,12-18)14-9-7-6-8-10-14/h6-10,13H,11-12H2,1-5H3,(H,19,20) |
| InChIKey | YYDZVZHYDYKQMU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|