C13H15ClF3NO2 — CID 103212847
N-(1-chloro-2-phenylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103212847) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is N-(1-chloro-2-phenylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(1-chloro-2-phenylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103212847 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(1-chloro-2-phenylpropan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(CCl)(NC(=O)COCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H15ClF3NO2/c1-12(8-14,10-5-3-2-4-6-10)18-11(19)7-20-9-13(15,16)17/h2-6H,7-9H2,1H3,(H,18,19) |
| InChIKey | OLECVJIWDWKOMO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|