C12H15F3N2O — CID 105060471
N-(1-amino-2-phenylpropan-2-yl)-3,3,3-trifluoropropanamide (PubChem CID 105060471) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(1-amino-2-phenylpropan-2-yl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(1-amino-2-phenylpropan-2-yl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 105060471 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(1-amino-2-phenylpropan-2-yl)-3,3,3-trifluoropropanamide |
| SMILES | CC(CN)(NC(=O)CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H15F3N2O/c1-11(8-16,9-5-3-2-4-6-9)17-10(18)7-12(13,14)15/h2-6H,7-8,16H2,1H3,(H,17,18) |
| InChIKey | FHNGDLHGLHEWEQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |