C12H12F3NO3 — CID 55078201
2-phenyl-2-(3,3,3-trifluoropropanoylamino)propanoic acid (PubChem CID 55078201) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-phenyl-2-(3,3,3-trifluoropropanoylamino)propanoic acid.
| Compound Name | 2-phenyl-2-(3,3,3-trifluoropropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 55078201 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-phenyl-2-(3,3,3-trifluoropropanoylamino)propanoic acid |
| SMILES | CC(NC(=O)CC(F)(F)F)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO3/c1-11(10(18)19,8-5-3-2-4-6-8)16-9(17)7-12(13,14)15/h2-6H,7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZOKNYQFHSJIBMT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |