C15H12F2N2S8 — CID 10505989
3-[[5-(2-cyanoethylsulfanyl)-2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile (PubChem CID 10505989) has the molecular formula C15H12F2N2S8 and a molecular weight of 514.81 g/mol. Its IUPAC name is 3-[[5-(2-cyanoethylsulfanyl)-2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(2-cyanoethylsulfanyl)-2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 10505989 |
| Molecular Formula | C15H12F2N2S8 |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 513.87 |
| IUPAC Name | 3-[[5-(2-cyanoethylsulfanyl)-2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiol-4-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSC1=C(SCCC#N)SC(=C2SC3=C(SCC(F)(F)CS3)S2)S1 |
| InChI | InChI=1S/C15H12F2N2S8/c16-15(17)7-22-11-12(23-8-15)27-14(26-11)13-24-9(20-5-1-3-18)10(25-13)21-6-2-4-19/h1-2,5-8H2 |
| InChIKey | LXPZWENHNOETQO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|