C18H20BrNO — CID 105059975
N-(1-bromo-2-phenylpropan-2-yl)-3,5-dimethylbenzamide (PubChem CID 105059975) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is N-(1-bromo-2-phenylpropan-2-yl)-3,5-dimethylbenzamide.
| Compound Name | N-(1-bromo-2-phenylpropan-2-yl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 105059975 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(1-bromo-2-phenylpropan-2-yl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(C)(CBr)c2ccccc2)c1 |
| InChI | InChI=1S/C18H20BrNO/c1-13-9-14(2)11-15(10-13)17(21)20-18(3,12-19)16-7-5-4-6-8-16/h4-11H,12H2,1-3H3,(H,20,21) |
| InChIKey | QBMPEGZSKFUSPW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|