C16H14BrClFNO — CID 107994349
N-(1-bromo-2-phenylpropan-2-yl)-4-chloro-3-fluorobenzamide (PubChem CID 107994349) has the molecular formula C16H14BrClFNO and a molecular weight of 370.65 g/mol. Its IUPAC name is N-(1-bromo-2-phenylpropan-2-yl)-4-chloro-3-fluorobenzamide.
| Compound Name | N-(1-bromo-2-phenylpropan-2-yl)-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 107994349 |
| Molecular Formula | C16H14BrClFNO |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | N-(1-bromo-2-phenylpropan-2-yl)-4-chloro-3-fluorobenzamide |
| SMILES | CC(CBr)(NC(=O)c1ccc(Cl)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14BrClFNO/c1-16(10-17,12-5-3-2-4-6-12)20-15(21)11-7-8-13(18)14(19)9-11/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | MARBQPPCNDRJOH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|