C14H17ClFNO3 — CID 120532577
3-[(4-chloro-3-fluorobenzoyl)amino]-3-ethylpentanoic acid (PubChem CID 120532577) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 3-[(4-chloro-3-fluorobenzoyl)amino]-3-ethylpentanoic acid.
| Compound Name | 3-[(4-chloro-3-fluorobenzoyl)amino]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 120532577 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[(4-chloro-3-fluorobenzoyl)amino]-3-ethylpentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H17ClFNO3/c1-3-14(4-2,8-12(18)19)17-13(20)9-5-6-10(15)11(16)7-9/h5-7H,3-4,8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | RBLQVWLIBQBILC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |