C19H27FN2O4 — CID 120532640
3-ethyl-3-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]pentanoic acid (PubChem CID 120532640) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-ethyl-3-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]pentanoic acid.
| Compound Name | 3-ethyl-3-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120532640 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3-ethyl-3-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]pentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)c1ccc(NC(=O)CC(C)C)c(F)c1 |
| InChI | InChI=1S/C19H27FN2O4/c1-5-19(6-2,11-17(24)25)22-18(26)13-7-8-15(14(20)10-13)21-16(23)9-12(3)4/h7-8,10,12H,5-6,9,11H2,1-4H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | KIWIQAWWBBCFSZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |