C15H19FN2O4 — CID 99776333
(2S)-2-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]propanoic acid (PubChem CID 99776333) has the molecular formula C15H19FN2O4 and a molecular weight of 310.33 g/mol. Its IUPAC name is (2S)-2-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 99776333 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2S)-2-[[3-fluoro-4-(3-methylbutanoylamino)benzoyl]amino]propanoic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)N[C@@H](C)C(=O)O)cc1F |
| InChI | InChI=1S/C15H19FN2O4/c1-8(2)6-13(19)18-12-5-4-10(7-11(12)16)14(20)17-9(3)15(21)22/h4-5,7-9H,6H2,1-3H3,(H,17,20)(H,18,19)(H,21,22)/t9-/m0/s1 |
| InChIKey | NCFFQQWNCKESKH-VIFPVBQESA-N |
| XLogP | 2.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |