C16H22ClNO3 — CID 120532514
3-[(2-chloro-4,5-dimethylbenzoyl)amino]-3-ethylpentanoic acid (PubChem CID 120532514) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-dimethylbenzoyl)amino]-3-ethylpentanoic acid.
| Compound Name | 3-[(2-chloro-4,5-dimethylbenzoyl)amino]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 120532514 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[(2-chloro-4,5-dimethylbenzoyl)amino]-3-ethylpentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C16H22ClNO3/c1-5-16(6-2,9-14(19)20)18-15(21)12-7-10(3)11(4)8-13(12)17/h7-8H,5-6,9H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | NXSGMHZHLKIWHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |