C16H27N3O3 — CID 120532558
3-ethyl-3-[[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]pentanoic acid (PubChem CID 120532558) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-ethyl-3-[[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | 3-ethyl-3-[[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120532558 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-ethyl-3-[[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)c1cnn(CC(C)C)c1C |
| InChI | InChI=1S/C16H27N3O3/c1-6-16(7-2,8-14(20)21)18-15(22)13-9-17-19(12(13)5)10-11(3)4/h9,11H,6-8,10H2,1-5H3,(H,18,22)(H,20,21) |
| InChIKey | CENCLYCFLOWNAS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |