C17H29N3O3 — CID 120532617
3-ethyl-3-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]pentanoic acid (PubChem CID 120532617) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-ethyl-3-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]pentanoic acid.
| Compound Name | 3-ethyl-3-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 120532617 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-ethyl-3-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]pentanoic acid |
| SMILES | CCC(CC)n1ncc(C(=O)NC(CC)(CC)CC(=O)O)c1C |
| InChI | InChI=1S/C17H29N3O3/c1-6-13(7-2)20-12(5)14(11-18-20)16(23)19-17(8-3,9-4)10-15(21)22/h11,13H,6-10H2,1-5H3,(H,19,23)(H,21,22) |
| InChIKey | KQWQVDGZDWZTSL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |