C11H16N6 — CID 105060698
2-N-(1-methyltetrazol-5-yl)-2-phenylpropane-1,2-diamine (PubChem CID 105060698) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-N-(1-methyltetrazol-5-yl)-2-phenylpropane-1,2-diamine.
| Compound Name | 2-N-(1-methyltetrazol-5-yl)-2-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 105060698 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-N-(1-methyltetrazol-5-yl)-2-phenylpropane-1,2-diamine |
| SMILES | Cn1nnnc1NC(C)(CN)c1ccccc1 |
| InChI | InChI=1S/C11H16N6/c1-11(8-12,9-6-4-3-5-7-9)13-10-14-15-16-17(10)2/h3-7H,8,12H2,1-2H3,(H,13,14,16) |
| InChIKey | FUTXTWLIBWDFAV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |