C11H18N2OS — CID 105061137
4-methyl-3-(2-piperidin-4-ylethyl)-1,3-thiazol-2-one (PubChem CID 105061137) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-methyl-3-(2-piperidin-4-ylethyl)-1,3-thiazol-2-one.
| Compound Name | 4-methyl-3-(2-piperidin-4-ylethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 105061137 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-methyl-3-(2-piperidin-4-ylethyl)-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCC1CCNCC1 |
| InChI | InChI=1S/C11H18N2OS/c1-9-8-15-11(14)13(9)7-4-10-2-5-12-6-3-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | RAKWCZDXOVZLGN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |