C16H27N3O2S — CID 51115790
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide (PubChem CID 51115790) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide.
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 51115790 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]propanamide |
| SMILES | Cc1csc(=O)n1CCC(=O)NCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C16H27N3O2S/c1-13-5-3-8-18(11-13)9-4-7-17-15(20)6-10-19-14(2)12-22-16(19)21/h12-13H,3-11H2,1-2H3,(H,17,20) |
| InChIKey | XXPIKMNIMMZRIA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|