C10H17N3O2 — CID 105061619
2-[2-(ethylamino)propyl]-6-methoxypyridazin-3-one (PubChem CID 105061619) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[2-(ethylamino)propyl]-6-methoxypyridazin-3-one.
| Compound Name | 2-[2-(ethylamino)propyl]-6-methoxypyridazin-3-one |
|---|---|
| PubChem CID | 105061619 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[2-(ethylamino)propyl]-6-methoxypyridazin-3-one |
| SMILES | CCNC(C)Cn1nc(OC)ccc1=O |
| InChI | InChI=1S/C10H17N3O2/c1-4-11-8(2)7-13-10(14)6-5-9(12-13)15-3/h5-6,8,11H,4,7H2,1-3H3 |
| InChIKey | MOBJWKMDOGLIJO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |