C16H14Cl2N2O — CID 105062320
3,5-dichloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)benzamide (PubChem CID 105062320) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)benzamide.
| Compound Name | 3,5-dichloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 105062320 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3,5-dichloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccc2c(c1)CNC2)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-14-4-12(5-15(18)6-14)16(21)20-7-10-1-2-11-8-19-9-13(11)3-10/h1-6,19H,7-9H2,(H,20,21) |
| InChIKey | TZPJNNFMAPERKJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |