C12H17N3O — CID 105357649
3-(2,3-dihydro-1H-isoindol-5-ylmethyl)-1,1-dimethylurea (PubChem CID 105357649) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-isoindol-5-ylmethyl)-1,1-dimethylurea.
| Compound Name | 3-(2,3-dihydro-1H-isoindol-5-ylmethyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 105357649 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-(2,3-dihydro-1H-isoindol-5-ylmethyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C12H17N3O/c1-15(2)12(16)14-6-9-3-4-10-7-13-8-11(10)5-9/h3-5,13H,6-8H2,1-2H3,(H,14,16) |
| InChIKey | MLSLGELZYWRFKK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |