About 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole
5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole (PubChem CID 105357723) has the molecular formula C13H21N3O2S
and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole |
| PubChem CID | 105357723 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole |
| SMILES | CC(C)N(C)S(=O)(=O)NCc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C13H21N3O2S/c1-10(2)16(3)19(17,18)15-7-11-4-5-12-8-14-9-13(12)6-11/h4-6,10,14-15H,7-9H2,1-3H3 |
| InChIKey | FQSWWXVEQDDBGV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole?
The IUPAC name of 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole (CID 105357723) is 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole?
The canonical SMILES for 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole is CC(C)N(C)S(=O)(=O)NCc1ccc2c(c1)CNC2.
What is the InChIKey of 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole?
The InChIKey is FQSWWXVEQDDBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S/c1-10(2)16(3)19(17,18)15-7-11-4-5-12-8-14-9-13(12)6-11/h4-6,10,14-15H,7-9H2,1-3H3.
What are the key properties of 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole?
5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole has a molecular weight of 283.40 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 105357723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).