C13H21ClN2O3S — CID 120724098
N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-ethoxyethanesulfonamide;hydrochloride (PubChem CID 120724098) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-ethoxyethanesulfonamide;hydrochloride.
| Compound Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-ethoxyethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120724098 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-ethoxyethanesulfonamide;hydrochloride |
| SMILES | CCOCCS(=O)(=O)NCc1ccc2c(c1)CNC2.Cl |
| InChI | InChI=1S/C13H20N2O3S.ClH/c1-2-18-5-6-19(16,17)15-8-11-3-4-12-9-14-10-13(12)7-11;/h3-4,7,14-15H,2,5-6,8-10H2,1H3;1H |
| InChIKey | UFICWMJXWOVCCL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|