C11H15N3O4S — CID 105357743
methyl N-(2,3-dihydro-1H-isoindol-5-ylmethylsulfamoyl)carbamate (PubChem CID 105357743) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl N-(2,3-dihydro-1H-isoindol-5-ylmethylsulfamoyl)carbamate.
| Compound Name | methyl N-(2,3-dihydro-1H-isoindol-5-ylmethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 105357743 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl N-(2,3-dihydro-1H-isoindol-5-ylmethylsulfamoyl)carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C11H15N3O4S/c1-18-11(15)14-19(16,17)13-5-8-2-3-9-6-12-7-10(9)4-8/h2-4,12-13H,5-7H2,1H3,(H,14,15) |
| InChIKey | SNGXCMZEAABOOL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |