C13H18N2O2S2 — CID 131900878
5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-1-benzothiophene (PubChem CID 131900878) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-1-benzothiophene.
| Compound Name | 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 131900878 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-[[[methyl(propan-2-yl)sulfamoyl]amino]methyl]-1-benzothiophene |
| SMILES | CC(C)N(C)S(=O)(=O)NCc1ccc2sccc2c1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-10(2)15(3)19(16,17)14-9-11-4-5-13-12(8-11)6-7-18-13/h4-8,10,14H,9H2,1-3H3 |
| InChIKey | HYEONAILHHQLEN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |