C17H23NO2S — CID 168763872
tert-butyl N-[(2S)-1-(1-benzothiophen-5-yl)propan-2-yl]-N-methylcarbamate (PubChem CID 168763872) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(1-benzothiophen-5-yl)propan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-(1-benzothiophen-5-yl)propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168763872 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-(1-benzothiophen-5-yl)propan-2-yl]-N-methylcarbamate |
| SMILES | C[C@@H](Cc1ccc2sccc2c1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO2S/c1-12(18(5)16(19)20-17(2,3)4)10-13-6-7-15-14(11-13)8-9-21-15/h6-9,11-12H,10H2,1-5H3/t12-/m0/s1 |
| InChIKey | DMTCDFWPXSYRDM-LBPRGKRZSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |