C18H19BrN2O2S2 — CID 67669679
methyl N-[2-(1-benzothiophen-5-yl)-1-[(4-bromothiophen-2-yl)methyl-methylamino]ethyl]carbamate (PubChem CID 67669679) has the molecular formula C18H19BrN2O2S2 and a molecular weight of 439.40 g/mol. Its IUPAC name is methyl N-[2-(1-benzothiophen-5-yl)-1-[(4-bromothiophen-2-yl)methyl-methylamino]ethyl]carbamate.
| Compound Name | methyl N-[2-(1-benzothiophen-5-yl)-1-[(4-bromothiophen-2-yl)methyl-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 67669679 |
| Molecular Formula | C18H19BrN2O2S2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | methyl N-[2-(1-benzothiophen-5-yl)-1-[(4-bromothiophen-2-yl)methyl-methylamino]ethyl]carbamate |
| SMILES | COC(=O)NC(Cc1ccc2sccc2c1)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C18H19BrN2O2S2/c1-21(10-15-9-14(19)11-25-15)17(20-18(22)23-2)8-12-3-4-16-13(7-12)5-6-24-16/h3-7,9,11,17H,8,10H2,1-2H3,(H,20,22) |
| InChIKey | XSDUAEDVMNBPOU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|